C16H19Cl2NO — CID 82985528
2-(2,4-dichlorophenyl)-3-oxo-4-propylheptanenitrile (PubChem CID 82985528) has the molecular formula C16H19Cl2NO and a molecular weight of 312.24 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-oxo-4-propylheptanenitrile.
| Compound Name | 2-(2,4-dichlorophenyl)-3-oxo-4-propylheptanenitrile |
|---|---|
| PubChem CID | 82985528 |
| Molecular Formula | C16H19Cl2NO |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-oxo-4-propylheptanenitrile |
| SMILES | CCCC(CCC)C(=O)C(C#N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H19Cl2NO/c1-3-5-11(6-4-2)16(20)14(10-19)13-8-7-12(17)9-15(13)18/h7-9,11,14H,3-6H2,1-2H3 |
| InChIKey | BPPWMUSMEVTVEQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |