C15H8Cl2INO — CID 43334391
2-(2,4-dichlorophenyl)-3-(2-iodophenyl)-3-oxopropanenitrile (PubChem CID 43334391) has the molecular formula C15H8Cl2INO and a molecular weight of 416.05 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-(2-iodophenyl)-3-oxopropanenitrile.
| Compound Name | 2-(2,4-dichlorophenyl)-3-(2-iodophenyl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 43334391 |
| Molecular Formula | C15H8Cl2INO |
| Molecular Weight | 416.05 g/mol |
| Exact Mass | 414.90 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-(2-iodophenyl)-3-oxopropanenitrile |
| SMILES | N#CC(C(=O)c1ccccc1I)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H8Cl2INO/c16-9-5-6-10(13(17)7-9)12(8-19)15(20)11-3-1-2-4-14(11)18/h1-7,12H |
| InChIKey | PXEOZZYWKMRJKV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.05 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|