C15H7ClF3NO — CID 79754893
2-(2-chlorophenyl)-3-oxo-3-(2,3,4-trifluorophenyl)propanenitrile (PubChem CID 79754893) has the molecular formula C15H7ClF3NO and a molecular weight of 309.67 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-oxo-3-(2,3,4-trifluorophenyl)propanenitrile.
| Compound Name | 2-(2-chlorophenyl)-3-oxo-3-(2,3,4-trifluorophenyl)propanenitrile |
|---|---|
| PubChem CID | 79754893 |
| Molecular Formula | C15H7ClF3NO |
| Molecular Weight | 309.67 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-(2-chlorophenyl)-3-oxo-3-(2,3,4-trifluorophenyl)propanenitrile |
| SMILES | N#CC(C(=O)c1ccc(F)c(F)c1F)c1ccccc1Cl |
| InChI | InChI=1S/C15H7ClF3NO/c16-11-4-2-1-3-8(11)10(7-20)15(21)9-5-6-12(17)14(19)13(9)18/h1-6,10H |
| InChIKey | TXPRKGDHTJWOTA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.67 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|