C13H6F3NOS — CID 79749228
3-oxo-2-thiophen-2-yl-3-(2,3,4-trifluorophenyl)propanenitrile (PubChem CID 79749228) has the molecular formula C13H6F3NOS and a molecular weight of 281.26 g/mol. Its IUPAC name is 3-oxo-2-thiophen-2-yl-3-(2,3,4-trifluorophenyl)propanenitrile.
| Compound Name | 3-oxo-2-thiophen-2-yl-3-(2,3,4-trifluorophenyl)propanenitrile |
|---|---|
| PubChem CID | 79749228 |
| Molecular Formula | C13H6F3NOS |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 3-oxo-2-thiophen-2-yl-3-(2,3,4-trifluorophenyl)propanenitrile |
| SMILES | N#CC(C(=O)c1ccc(F)c(F)c1F)c1cccs1 |
| InChI | InChI=1S/C13H6F3NOS/c14-9-4-3-7(11(15)12(9)16)13(18)8(6-17)10-2-1-5-19-10/h1-5,8H |
| InChIKey | JGAHGMSNFMOECH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|