C13H9FN2OS — CID 13075817
N-[cyano(thiophen-2-yl)methyl]-2-fluorobenzamide (PubChem CID 13075817) has the molecular formula C13H9FN2OS and a molecular weight of 260.29 g/mol. Its IUPAC name is N-[cyano(thiophen-2-yl)methyl]-2-fluorobenzamide.
| Compound Name | N-[cyano(thiophen-2-yl)methyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 13075817 |
| Molecular Formula | C13H9FN2OS |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | N-[cyano(thiophen-2-yl)methyl]-2-fluorobenzamide |
| SMILES | N#CC(NC(=O)c1ccccc1F)c1cccs1 |
| InChI | InChI=1S/C13H9FN2OS/c14-10-5-2-1-4-9(10)13(17)16-11(8-15)12-6-3-7-18-12/h1-7,11H,(H,16,17) |
| InChIKey | IQESQCGWKOJWLY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |