C11H8N2O2S — CID 13075816
N-[cyano(thiophen-2-yl)methyl]furan-2-carboxamide (PubChem CID 13075816) has the molecular formula C11H8N2O2S and a molecular weight of 232.26 g/mol. Its IUPAC name is N-[cyano(thiophen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[cyano(thiophen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 13075816 |
| Molecular Formula | C11H8N2O2S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | N-[cyano(thiophen-2-yl)methyl]furan-2-carboxamide |
| SMILES | N#CC(NC(=O)c1ccco1)c1cccs1 |
| InChI | InChI=1S/C11H8N2O2S/c12-7-8(10-4-2-6-16-10)13-11(14)9-3-1-5-15-9/h1-6,8H,(H,13,14) |
| InChIKey | UYXIRCRKAWKCGZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |