C11H9NO4S — CID 34317354
N-[(1R)-1-hydroxy-2-oxo-2-thiophen-2-ylethyl]furan-2-carboxamide (PubChem CID 34317354) has the molecular formula C11H9NO4S and a molecular weight of 251.26 g/mol. Its IUPAC name is N-[(1R)-1-hydroxy-2-oxo-2-thiophen-2-ylethyl]furan-2-carboxamide.
| Compound Name | N-[(1R)-1-hydroxy-2-oxo-2-thiophen-2-ylethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 34317354 |
| Molecular Formula | C11H9NO4S |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | N-[(1R)-1-hydroxy-2-oxo-2-thiophen-2-ylethyl]furan-2-carboxamide |
| SMILES | O=C(N[C@H](O)C(=O)c1cccs1)c1ccco1 |
| InChI | InChI=1S/C11H9NO4S/c13-9(8-4-2-6-17-8)11(15)12-10(14)7-3-1-5-16-7/h1-6,11,15H,(H,12,14)/t11-/m1/s1 |
| InChIKey | HTTHHXJHGQRFIM-LLVKDONJSA-N |
| XLogP | 1.27 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|