C11H10N2O2S — CID 2715141
N'-[1-(furan-2-yl)ethenyl]thiophene-2-carbohydrazide (PubChem CID 2715141) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is N'-[1-(furan-2-yl)ethenyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[1-(furan-2-yl)ethenyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 2715141 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | N'-[1-(furan-2-yl)ethenyl]thiophene-2-carbohydrazide |
| SMILES | C=C(NNC(=O)c1cccs1)c1ccco1 |
| InChI | InChI=1S/C11H10N2O2S/c1-8(9-4-2-6-15-9)12-13-11(14)10-5-3-7-16-10/h2-7,12H,1H2,(H,13,14) |
| InChIKey | MYSGDWYXTJQGAP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|