C21H18N2O6S — CID 55358067
[2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-(furan-2-carbonylamino)-3-phenylpropanoate (PubChem CID 55358067) has the molecular formula C21H18N2O6S and a molecular weight of 426.45 g/mol. Its IUPAC name is [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-(furan-2-carbonylamino)-3-phenylpropanoate.
| Compound Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-(furan-2-carbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 55358067 |
| Molecular Formula | C21H18N2O6S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-(furan-2-carbonylamino)-3-phenylpropanoate |
| SMILES | O=C(COC(=O)C(Cc1ccccc1)NC(=O)c1ccco1)NC(=O)c1cccs1 |
| InChI | InChI=1S/C21H18N2O6S/c24-18(23-20(26)17-9-5-11-30-17)13-29-21(27)15(12-14-6-2-1-3-7-14)22-19(25)16-8-4-10-28-16/h1-11,15H,12-13H2,(H,22,25)(H,23,24,26) |
| InChIKey | CZGZXBAZLVXQIB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |