C30H22N2O7 — CID 5109807
[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)-3-phenylpropanoate (PubChem CID 5109807) has the molecular formula C30H22N2O7 and a molecular weight of 522.51 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)-3-phenylpropanoate.
| Compound Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 5109807 |
| Molecular Formula | C30H22N2O7 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)-3-phenylpropanoate |
| SMILES | O=C(COC(=O)C(Cc1ccccc1)NC(=O)c1ccco1)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C30H22N2O7/c33-25(31-22-13-6-12-21-26(22)28(35)20-11-5-4-10-19(20)27(21)34)17-39-30(37)23(16-18-8-2-1-3-9-18)32-29(36)24-14-7-15-38-24/h1-15,23H,16-17H2,(H,31,33)(H,32,36) |
| InChIKey | IKQDSPWGYDMIBT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|