C13H7Cl2NOS — CID 55079083
3-(3,5-dichlorophenyl)-3-oxo-2-thiophen-2-ylpropanenitrile (PubChem CID 55079083) has the molecular formula C13H7Cl2NOS and a molecular weight of 296.18 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-3-oxo-2-thiophen-2-ylpropanenitrile.
| Compound Name | 3-(3,5-dichlorophenyl)-3-oxo-2-thiophen-2-ylpropanenitrile |
|---|---|
| PubChem CID | 55079083 |
| Molecular Formula | C13H7Cl2NOS |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 294.96 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-3-oxo-2-thiophen-2-ylpropanenitrile |
| SMILES | N#CC(C(=O)c1cc(Cl)cc(Cl)c1)c1cccs1 |
| InChI | InChI=1S/C13H7Cl2NOS/c14-9-4-8(5-10(15)6-9)13(17)11(7-16)12-2-1-3-18-12/h1-6,11H |
| InChIKey | SKDUJYHQAICYLE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |