C13H13Cl2NO — CID 13374432
2-(2,4-dichlorophenyl)-5-methyl-3-oxohexanenitrile (PubChem CID 13374432) has the molecular formula C13H13Cl2NO and a molecular weight of 270.16 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-5-methyl-3-oxohexanenitrile.
| Compound Name | 2-(2,4-dichlorophenyl)-5-methyl-3-oxohexanenitrile |
|---|---|
| PubChem CID | 13374432 |
| Molecular Formula | C13H13Cl2NO |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-5-methyl-3-oxohexanenitrile |
| SMILES | CC(C)CC(=O)C(C#N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl2NO/c1-8(2)5-13(17)11(7-16)10-4-3-9(14)6-12(10)15/h3-4,6,8,11H,5H2,1-2H3 |
| InChIKey | YAKZQTUQZCNFMT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |