C13H7Cl2NO2 — CID 43334414
2-(2,4-dichlorophenyl)-3-(furan-3-yl)-3-oxopropanenitrile (PubChem CID 43334414) has the molecular formula C13H7Cl2NO2 and a molecular weight of 280.11 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-(furan-3-yl)-3-oxopropanenitrile.
| Compound Name | 2-(2,4-dichlorophenyl)-3-(furan-3-yl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 43334414 |
| Molecular Formula | C13H7Cl2NO2 |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-(furan-3-yl)-3-oxopropanenitrile |
| SMILES | N#CC(C(=O)c1ccoc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H7Cl2NO2/c14-9-1-2-10(12(15)5-9)11(6-16)13(17)8-3-4-18-7-8/h1-5,7,11H |
| InChIKey | VXYNMCXNAFTMIV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |