C21H24O9 — CID 10526141
[2-acetyl-3,5,6-trimethoxy-4-(methoxymethoxy)phenyl] 4-methoxybenzoate (PubChem CID 10526141) has the molecular formula C21H24O9 and a molecular weight of 420.41 g/mol. Its IUPAC name is [2-acetyl-3,5,6-trimethoxy-4-(methoxymethoxy)phenyl] 4-methoxybenzoate.
| Compound Name | [2-acetyl-3,5,6-trimethoxy-4-(methoxymethoxy)phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 10526141 |
| Molecular Formula | C21H24O9 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | [2-acetyl-3,5,6-trimethoxy-4-(methoxymethoxy)phenyl] 4-methoxybenzoate |
| SMILES | COCOc1c(OC)c(OC)c(OC(=O)c2ccc(OC)cc2)c(C(C)=O)c1OC |
| InChI | InChI=1S/C21H24O9/c1-12(22)15-16(26-4)20(29-11-24-2)19(28-6)18(27-5)17(15)30-21(23)13-7-9-14(25-3)10-8-13/h7-10H,11H2,1-6H3 |
| InChIKey | KYLMGVPJVIEGMP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|