C13H18O7 — CID 168863304
1-[2-hydroxy-4,5,6-trimethoxy-3-(methoxymethoxy)phenyl]ethanone (PubChem CID 168863304) has the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. Its IUPAC name is 1-[2-hydroxy-4,5,6-trimethoxy-3-(methoxymethoxy)phenyl]ethanone.
| Compound Name | 1-[2-hydroxy-4,5,6-trimethoxy-3-(methoxymethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 168863304 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1-[2-hydroxy-4,5,6-trimethoxy-3-(methoxymethoxy)phenyl]ethanone |
| SMILES | COCOc1c(O)c(C(C)=O)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C13H18O7/c1-7(14)8-9(15)11(20-6-16-2)13(19-5)12(18-4)10(8)17-3/h15H,6H2,1-5H3 |
| InChIKey | OACCAPGPBXWIFD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|