C18H15BrO5 — CID 11618060
1-[7-[(4-bromophenyl)methoxy]-6-hydroxy-4-methoxy-1-benzofuran-5-yl]ethanone (PubChem CID 11618060) has the molecular formula C18H15BrO5 and a molecular weight of 391.22 g/mol. Its IUPAC name is 1-[7-[(4-bromophenyl)methoxy]-6-hydroxy-4-methoxy-1-benzofuran-5-yl]ethanone.
| Compound Name | 1-[7-[(4-bromophenyl)methoxy]-6-hydroxy-4-methoxy-1-benzofuran-5-yl]ethanone |
|---|---|
| PubChem CID | 11618060 |
| Molecular Formula | C18H15BrO5 |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 1-[7-[(4-bromophenyl)methoxy]-6-hydroxy-4-methoxy-1-benzofuran-5-yl]ethanone |
| SMILES | COc1c(C(C)=O)c(O)c(OCc2ccc(Br)cc2)c2occc12 |
| InChI | InChI=1S/C18H15BrO5/c1-10(20)14-15(21)18(17-13(7-8-23-17)16(14)22-2)24-9-11-3-5-12(19)6-4-11/h3-8,21H,9H2,1-2H3 |
| InChIKey | JVIQXYQBYHGBQA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |