C17H21NO6 — CID 59272429
1-[6-hydroxy-4-methoxy-7-(2-morpholin-4-ylethoxy)-1-benzofuran-5-yl]ethanone (PubChem CID 59272429) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is 1-[6-hydroxy-4-methoxy-7-(2-morpholin-4-ylethoxy)-1-benzofuran-5-yl]ethanone.
| Compound Name | 1-[6-hydroxy-4-methoxy-7-(2-morpholin-4-ylethoxy)-1-benzofuran-5-yl]ethanone |
|---|---|
| PubChem CID | 59272429 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1-[6-hydroxy-4-methoxy-7-(2-morpholin-4-ylethoxy)-1-benzofuran-5-yl]ethanone |
| SMILES | COc1c(C(C)=O)c(O)c(OCCN2CCOCC2)c2occc12 |
| InChI | InChI=1S/C17H21NO6/c1-11(19)13-14(20)17(16-12(3-7-23-16)15(13)21-2)24-10-6-18-4-8-22-9-5-18/h3,7,20H,4-6,8-10H2,1-2H3 |
| InChIKey | QWBNRAJROKUXLQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |