C26H29NO5 — CID 68708739
1-[4-methyl-6-(2-morpholin-4-ylethoxy)-7-(3-phenylprop-2-enoxy)-1-benzofuran-5-yl]ethanone (PubChem CID 68708739) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is 1-[4-methyl-6-(2-morpholin-4-ylethoxy)-7-(3-phenylprop-2-enoxy)-1-benzofuran-5-yl]ethanone.
| Compound Name | 1-[4-methyl-6-(2-morpholin-4-ylethoxy)-7-(3-phenylprop-2-enoxy)-1-benzofuran-5-yl]ethanone |
|---|---|
| PubChem CID | 68708739 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 1-[4-methyl-6-(2-morpholin-4-ylethoxy)-7-(3-phenylprop-2-enoxy)-1-benzofuran-5-yl]ethanone |
| SMILES | CC(=O)c1c(OCCN2CCOCC2)c(OCC=Cc2ccccc2)c2occc2c1C |
| InChI | InChI=1S/C26H29NO5/c1-19-22-10-15-31-24(22)26(30-14-6-9-21-7-4-3-5-8-21)25(23(19)20(2)28)32-18-13-27-11-16-29-17-12-27/h3-10,15H,11-14,16-18H2,1-2H3 |
| InChIKey | NJNINYHVEYCVRD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |