C27H35ClFNO5 — CID 91336720
1-[3-chloro-5-[4-(2-fluorophenyl)butoxy]-4-methoxy-2-methyl-6-(3-morpholin-4-ylpropoxy)phenyl]ethanone (PubChem CID 91336720) has the molecular formula C27H35ClFNO5 and a molecular weight of 508.03 g/mol. Its IUPAC name is 1-[3-chloro-5-[4-(2-fluorophenyl)butoxy]-4-methoxy-2-methyl-6-(3-morpholin-4-ylpropoxy)phenyl]ethanone.
| Compound Name | 1-[3-chloro-5-[4-(2-fluorophenyl)butoxy]-4-methoxy-2-methyl-6-(3-morpholin-4-ylpropoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 91336720 |
| Molecular Formula | C27H35ClFNO5 |
| Molecular Weight | 508.03 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 1-[3-chloro-5-[4-(2-fluorophenyl)butoxy]-4-methoxy-2-methyl-6-(3-morpholin-4-ylpropoxy)phenyl]ethanone |
| SMILES | COc1c(Cl)c(C)c(C(C)=O)c(OCCCN2CCOCC2)c1OCCCCc1ccccc1F |
| InChI | InChI=1S/C27H35ClFNO5/c1-19-23(20(2)31)25(34-16-8-12-30-13-17-33-18-14-30)27(26(32-3)24(19)28)35-15-7-6-10-21-9-4-5-11-22(21)29/h4-5,9,11H,6-8,10,12-18H2,1-3H3 |
| InChIKey | CMKSZJCZVKYNHS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.03 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|