C26H29NO6 — CID 74381937
1-[4-methyl-6-(2-morpholin-4-ylethoxy)-7-[(3-phenyloxiran-2-yl)methoxy]-1-benzofuran-5-yl]ethanone (PubChem CID 74381937) has the molecular formula C26H29NO6 and a molecular weight of 451.52 g/mol. Its IUPAC name is 1-[4-methyl-6-(2-morpholin-4-ylethoxy)-7-[(3-phenyloxiran-2-yl)methoxy]-1-benzofuran-5-yl]ethanone.
| Compound Name | 1-[4-methyl-6-(2-morpholin-4-ylethoxy)-7-[(3-phenyloxiran-2-yl)methoxy]-1-benzofuran-5-yl]ethanone |
|---|---|
| PubChem CID | 74381937 |
| Molecular Formula | C26H29NO6 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 1-[4-methyl-6-(2-morpholin-4-ylethoxy)-7-[(3-phenyloxiran-2-yl)methoxy]-1-benzofuran-5-yl]ethanone |
| SMILES | CC(=O)c1c(OCCN2CCOCC2)c(OCC2OC2c2ccccc2)c2occc2c1C |
| InChI | InChI=1S/C26H29NO6/c1-17-20-8-12-30-24(20)26(32-16-21-23(33-21)19-6-4-3-5-7-19)25(22(17)18(2)28)31-15-11-27-9-13-29-14-10-27/h3-8,12,21,23H,9-11,13-16H2,1-2H3 |
| InChIKey | JUFPZCPSYMNDNU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 73.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|