C27H33NO5 — CID 24992606
1-[4-methyl-6-(2-morpholin-4-ylethoxy)-7-(3-phenylbutoxy)-1-benzofuran-5-yl]ethanone (PubChem CID 24992606) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is 1-[4-methyl-6-(2-morpholin-4-ylethoxy)-7-(3-phenylbutoxy)-1-benzofuran-5-yl]ethanone.
| Compound Name | 1-[4-methyl-6-(2-morpholin-4-ylethoxy)-7-(3-phenylbutoxy)-1-benzofuran-5-yl]ethanone |
|---|---|
| PubChem CID | 24992606 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 1-[4-methyl-6-(2-morpholin-4-ylethoxy)-7-(3-phenylbutoxy)-1-benzofuran-5-yl]ethanone |
| SMILES | CC(=O)c1c(OCCN2CCOCC2)c(OCCC(C)c2ccccc2)c2occc2c1C |
| InChI | InChI=1S/C27H33NO5/c1-19(22-7-5-4-6-8-22)9-14-32-27-25-23(10-15-31-25)20(2)24(21(3)29)26(27)33-18-13-28-11-16-30-17-12-28/h4-8,10,15,19H,9,11-14,16-18H2,1-3H3 |
| InChIKey | DENBPILNGNVKKV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |