C21H21FO4 — CID 59272432
1-[7-[3-(4-fluorophenyl)butoxy]-6-hydroxy-4-methyl-1-benzofuran-5-yl]ethanone (PubChem CID 59272432) has the molecular formula C21H21FO4 and a molecular weight of 356.39 g/mol. Its IUPAC name is 1-[7-[3-(4-fluorophenyl)butoxy]-6-hydroxy-4-methyl-1-benzofuran-5-yl]ethanone.
| Compound Name | 1-[7-[3-(4-fluorophenyl)butoxy]-6-hydroxy-4-methyl-1-benzofuran-5-yl]ethanone |
|---|---|
| PubChem CID | 59272432 |
| Molecular Formula | C21H21FO4 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-[7-[3-(4-fluorophenyl)butoxy]-6-hydroxy-4-methyl-1-benzofuran-5-yl]ethanone |
| SMILES | CC(=O)c1c(O)c(OCCC(C)c2ccc(F)cc2)c2occc2c1C |
| InChI | InChI=1S/C21H21FO4/c1-12(15-4-6-16(22)7-5-15)8-10-26-21-19(24)18(14(3)23)13(2)17-9-11-25-20(17)21/h4-7,9,11-12,24H,8,10H2,1-3H3 |
| InChIKey | CEPLQOZAQPEWAJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |