C24H28FNO5 — CID 87349387
N-[5-acetyl-3-[3-(4-fluorophenyl)butoxy]-2-hydroxy-4-methoxy-6-methylphenyl]cyclopropanecarboxamide (PubChem CID 87349387) has the molecular formula C24H28FNO5 and a molecular weight of 429.49 g/mol. Its IUPAC name is N-[5-acetyl-3-[3-(4-fluorophenyl)butoxy]-2-hydroxy-4-methoxy-6-methylphenyl]cyclopropanecarboxamide.
| Compound Name | N-[5-acetyl-3-[3-(4-fluorophenyl)butoxy]-2-hydroxy-4-methoxy-6-methylphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 87349387 |
| Molecular Formula | C24H28FNO5 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | N-[5-acetyl-3-[3-(4-fluorophenyl)butoxy]-2-hydroxy-4-methoxy-6-methylphenyl]cyclopropanecarboxamide |
| SMILES | COc1c(OCCC(C)c2ccc(F)cc2)c(O)c(NC(=O)C2CC2)c(C)c1C(C)=O |
| InChI | InChI=1S/C24H28FNO5/c1-13(16-7-9-18(25)10-8-16)11-12-31-23-21(28)20(26-24(29)17-5-6-17)14(2)19(15(3)27)22(23)30-4/h7-10,13,17,28H,5-6,11-12H2,1-4H3,(H,26,29) |
| InChIKey | OSVRNGKHWAJIQQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|