C29H28BrF2NO4 — CID 67069979
1-[7-[1,3-bis(4-fluorophenyl)butoxy]-6-(2-bromoethoxy)-2,4-dimethyl-1,3-benzoxazol-5-yl]ethanone (PubChem CID 67069979) has the molecular formula C29H28BrF2NO4 and a molecular weight of 572.45 g/mol. Its IUPAC name is 1-[7-[1,3-bis(4-fluorophenyl)butoxy]-6-(2-bromoethoxy)-2,4-dimethyl-1,3-benzoxazol-5-yl]ethanone.
| Compound Name | 1-[7-[1,3-bis(4-fluorophenyl)butoxy]-6-(2-bromoethoxy)-2,4-dimethyl-1,3-benzoxazol-5-yl]ethanone |
|---|---|
| PubChem CID | 67069979 |
| Molecular Formula | C29H28BrF2NO4 |
| Molecular Weight | 572.45 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | 1-[7-[1,3-bis(4-fluorophenyl)butoxy]-6-(2-bromoethoxy)-2,4-dimethyl-1,3-benzoxazol-5-yl]ethanone |
| SMILES | CC(=O)c1c(OCCBr)c(OC(CC(C)c2ccc(F)cc2)c2ccc(F)cc2)c2oc(C)nc2c1C |
| InChI | InChI=1S/C29H28BrF2NO4/c1-16(20-5-9-22(31)10-6-20)15-24(21-7-11-23(32)12-8-21)37-29-27(35-14-13-30)25(18(3)34)17(2)26-28(29)36-19(4)33-26/h5-12,16,24H,13-15H2,1-4H3 |
| InChIKey | CBOKTEXUNNHXDZ-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.45 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|