C21H14N4O5 — CID 130471856
2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-5-nitrobenzo[de]isoquinoline-1,3-dione (PubChem CID 130471856) has the molecular formula C21H14N4O5 and a molecular weight of 402.37 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-5-nitrobenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-5-nitrobenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 130471856 |
| Molecular Formula | C21H14N4O5 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 2-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-5-nitrobenzo[de]isoquinoline-1,3-dione |
| SMILES | Cn1c(=O)n(C)c2cc(N3C(=O)c4cccc5cc([N+](=O)[O-])cc(c45)C3=O)ccc21 |
| InChI | InChI=1S/C21H14N4O5/c1-22-16-7-6-12(10-17(16)23(2)21(22)28)24-19(26)14-5-3-4-11-8-13(25(29)30)9-15(18(11)14)20(24)27/h3-10H,1-2H3 |
| InChIKey | PYLBPMAQUFESLJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 107.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|