C18H16N2O6 — CID 139247299
(2S)-3,3-dimethyl-2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)butanoic acid (PubChem CID 139247299) has the molecular formula C18H16N2O6 and a molecular weight of 356.33 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)butanoic acid.
| Compound Name | (2S)-3,3-dimethyl-2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)butanoic acid |
|---|---|
| PubChem CID | 139247299 |
| Molecular Formula | C18H16N2O6 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (2S)-3,3-dimethyl-2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)butanoic acid |
| SMILES | CC(C)(C)[C@@H](C(=O)O)N1C(=O)c2cccc3cc([N+](=O)[O-])cc(c23)C1=O |
| InChI | InChI=1S/C18H16N2O6/c1-18(2,3)14(17(23)24)19-15(21)11-6-4-5-9-7-10(20(25)26)8-12(13(9)11)16(19)22/h4-8,14H,1-3H3,(H,23,24)/t14-/m1/s1 |
| InChIKey | VVDNRCCTZQVXRP-CQSZACIVSA-N |
| XLogP | 2.84 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|