C19H10N2O7 — CID 71234740
4-hydroxy-2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)benzoic acid (PubChem CID 71234740) has the molecular formula C19H10N2O7 and a molecular weight of 378.30 g/mol. Its IUPAC name is 4-hydroxy-2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)benzoic acid.
| Compound Name | 4-hydroxy-2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)benzoic acid |
|---|---|
| PubChem CID | 71234740 |
| Molecular Formula | C19H10N2O7 |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 4-hydroxy-2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(O)cc1N1C(=O)c2cccc3cc([N+](=O)[O-])cc(c23)C1=O |
| InChI | InChI=1S/C19H10N2O7/c22-11-4-5-12(19(25)26)15(8-11)20-17(23)13-3-1-2-9-6-10(21(27)28)7-14(16(9)13)18(20)24/h1-8,22H,(H,25,26) |
| InChIKey | CVWBRXJASAIRKN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|