C18H17N3O5 — CID 12680935
2-(2-morpholin-4-ylethyl)-5-nitrobenzo[de]isoquinoline-1,3-dione (PubChem CID 12680935) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is 2-(2-morpholin-4-ylethyl)-5-nitrobenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(2-morpholin-4-ylethyl)-5-nitrobenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 12680935 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-(2-morpholin-4-ylethyl)-5-nitrobenzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3cc([N+](=O)[O-])cc(c23)C(=O)N1CCN1CCOCC1 |
| InChI | InChI=1S/C18H17N3O5/c22-17-14-3-1-2-12-10-13(21(24)25)11-15(16(12)14)18(23)20(17)5-4-19-6-8-26-9-7-19/h1-3,10-11H,4-9H2 |
| InChIKey | MQBIIGAYEJQXCC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|