C28H14N2O10 — CID 102524592
2-[13-(2-carboxy-4-hydroxyphenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]-5-hydroxybenzoic acid (PubChem CID 102524592) has the molecular formula C28H14N2O10 and a molecular weight of 538.42 g/mol. Its IUPAC name is 2-[13-(2-carboxy-4-hydroxyphenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]-5-hydroxybenzoic acid.
| Compound Name | 2-[13-(2-carboxy-4-hydroxyphenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 102524592 |
| Molecular Formula | C28H14N2O10 |
| Molecular Weight | 538.42 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | 2-[13-(2-carboxy-4-hydroxyphenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]-5-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(O)ccc1N1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(c1ccc(O)cc1C(=O)O)C3=O |
| InChI | InChI=1S/C28H14N2O10/c31-11-1-7-19(17(9-11)27(37)38)29-23(33)13-3-5-15-22-16(6-4-14(21(13)22)24(29)34)26(36)30(25(15)35)20-8-2-12(32)10-18(20)28(39)40/h1-10,31-32H,(H,37,38)(H,39,40) |
| InChIKey | HAKQPTGQQRGBDI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 189.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|