C14H13NO5 — CID 103551454
2-(2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)-5-hydroxybenzoic acid (PubChem CID 103551454) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is 2-(2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)-5-hydroxybenzoic acid.
| Compound Name | 2-(2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 103551454 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-(2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)-5-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(O)ccc1N1C(=O)C2CCC(C2)C1=O |
| InChI | InChI=1S/C14H13NO5/c16-9-3-4-11(10(6-9)14(19)20)15-12(17)7-1-2-8(5-7)13(15)18/h3-4,6-8,16H,1-2,5H2,(H,19,20) |
| InChIKey | DWTGWZQYHQLYAY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|