C17H14BrNO2 — CID 103551968
3-(4-bromonaphthalen-1-yl)-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 103551968) has the molecular formula C17H14BrNO2 and a molecular weight of 344.21 g/mol. Its IUPAC name is 3-(4-bromonaphthalen-1-yl)-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-(4-bromonaphthalen-1-yl)-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 103551968 |
| Molecular Formula | C17H14BrNO2 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 3-(4-bromonaphthalen-1-yl)-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | O=C1C2CCC(C2)C(=O)N1c1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C17H14BrNO2/c18-14-7-8-15(13-4-2-1-3-12(13)14)19-16(20)10-5-6-11(9-10)17(19)21/h1-4,7-8,10-11H,5-6,9H2 |
| InChIKey | NJKJLUKJHOTPDY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|