C13H11ClINO2 — CID 107640934
3-(4-chloro-2-iodophenyl)-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 107640934) has the molecular formula C13H11ClINO2 and a molecular weight of 375.59 g/mol. Its IUPAC name is 3-(4-chloro-2-iodophenyl)-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-(4-chloro-2-iodophenyl)-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 107640934 |
| Molecular Formula | C13H11ClINO2 |
| Molecular Weight | 375.59 g/mol |
| Exact Mass | 374.95 |
| IUPAC Name | 3-(4-chloro-2-iodophenyl)-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | O=C1C2CCC(C2)C(=O)N1c1ccc(Cl)cc1I |
| InChI | InChI=1S/C13H11ClINO2/c14-9-3-4-11(10(15)6-9)16-12(17)7-1-2-8(5-7)13(16)18/h3-4,6-8H,1-2,5H2 |
| InChIKey | UGFAGLWTPRVENO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|