C14H18ClIN2O — CID 107639769
1-(4-chloro-2-iodophenyl)-3-(propan-2-ylamino)piperidin-2-one (PubChem CID 107639769) has the molecular formula C14H18ClIN2O and a molecular weight of 392.67 g/mol. Its IUPAC name is 1-(4-chloro-2-iodophenyl)-3-(propan-2-ylamino)piperidin-2-one.
| Compound Name | 1-(4-chloro-2-iodophenyl)-3-(propan-2-ylamino)piperidin-2-one |
|---|---|
| PubChem CID | 107639769 |
| Molecular Formula | C14H18ClIN2O |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 1-(4-chloro-2-iodophenyl)-3-(propan-2-ylamino)piperidin-2-one |
| SMILES | CC(C)NC1CCCN(c2ccc(Cl)cc2I)C1=O |
| InChI | InChI=1S/C14H18ClIN2O/c1-9(2)17-12-4-3-7-18(14(12)19)13-6-5-10(15)8-11(13)16/h5-6,8-9,12,17H,3-4,7H2,1-2H3 |
| InChIKey | UYGXKOCPYVLCGF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|