C12H14BrIN2O — CID 114261349
1-(2-bromo-4-iodophenyl)-3-(methylamino)piperidin-2-one (PubChem CID 114261349) has the molecular formula C12H14BrIN2O and a molecular weight of 409.07 g/mol. Its IUPAC name is 1-(2-bromo-4-iodophenyl)-3-(methylamino)piperidin-2-one.
| Compound Name | 1-(2-bromo-4-iodophenyl)-3-(methylamino)piperidin-2-one |
|---|---|
| PubChem CID | 114261349 |
| Molecular Formula | C12H14BrIN2O |
| Molecular Weight | 409.07 g/mol |
| Exact Mass | 407.93 |
| IUPAC Name | 1-(2-bromo-4-iodophenyl)-3-(methylamino)piperidin-2-one |
| SMILES | CNC1CCCN(c2ccc(I)cc2Br)C1=O |
| InChI | InChI=1S/C12H14BrIN2O/c1-15-10-3-2-6-16(12(10)17)11-5-4-8(14)7-9(11)13/h4-5,7,10,15H,2-3,6H2,1H3 |
| InChIKey | RUGJUQVQRQWDLU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.07 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|