C12H12BrN3O — CID 114002202
3-bromo-4-[3-(methylamino)-2-oxopyrrolidin-1-yl]benzonitrile (PubChem CID 114002202) has the molecular formula C12H12BrN3O and a molecular weight of 294.15 g/mol. Its IUPAC name is 3-bromo-4-[3-(methylamino)-2-oxopyrrolidin-1-yl]benzonitrile.
| Compound Name | 3-bromo-4-[3-(methylamino)-2-oxopyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 114002202 |
| Molecular Formula | C12H12BrN3O |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 3-bromo-4-[3-(methylamino)-2-oxopyrrolidin-1-yl]benzonitrile |
| SMILES | CNC1CCN(c2ccc(C#N)cc2Br)C1=O |
| InChI | InChI=1S/C12H12BrN3O/c1-15-10-4-5-16(12(10)17)11-3-2-8(7-14)6-9(11)13/h2-3,6,10,15H,4-5H2,1H3 |
| InChIKey | DMNSMFXXEWTBKG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |