C13H15BrCl2N2O — CID 107794247
1-(4-bromo-2,3-dichlorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one (PubChem CID 107794247) has the molecular formula C13H15BrCl2N2O and a molecular weight of 366.09 g/mol. Its IUPAC name is 1-(4-bromo-2,3-dichlorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one.
| Compound Name | 1-(4-bromo-2,3-dichlorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one |
|---|---|
| PubChem CID | 107794247 |
| Molecular Formula | C13H15BrCl2N2O |
| Molecular Weight | 366.09 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | 1-(4-bromo-2,3-dichlorophenyl)-3-(propan-2-ylamino)pyrrolidin-2-one |
| SMILES | CC(C)NC1CCN(c2ccc(Br)c(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C13H15BrCl2N2O/c1-7(2)17-9-5-6-18(13(9)19)10-4-3-8(14)11(15)12(10)16/h3-4,7,9,17H,5-6H2,1-2H3 |
| InChIKey | IFJYMDMHARFHNH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.09 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|