C31H16N4O12 — CID 9499746
5-[[3-carboxy-4-(5-nitro-1,3-dioxoisoindol-2-yl)phenyl]methyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)benzoic acid (PubChem CID 9499746) has the molecular formula C31H16N4O12 and a molecular weight of 636.49 g/mol. Its IUPAC name is 5-[[3-carboxy-4-(5-nitro-1,3-dioxoisoindol-2-yl)phenyl]methyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)benzoic acid.
| Compound Name | 5-[[3-carboxy-4-(5-nitro-1,3-dioxoisoindol-2-yl)phenyl]methyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 9499746 |
| Molecular Formula | C31H16N4O12 |
| Molecular Weight | 636.49 g/mol |
| Exact Mass | 636.08 |
| IUPAC Name | 5-[[3-carboxy-4-(5-nitro-1,3-dioxoisoindol-2-yl)phenyl]methyl]-2-(5-nitro-1,3-dioxoisoindol-2-yl)benzoic acid |
| SMILES | O=C(O)c1cc(Cc2ccc(N3C(=O)c4ccc([N+](=O)[O-])cc4C3=O)c(C(=O)O)c2)ccc1N1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C31H16N4O12/c36-26-18-5-3-16(34(44)45)12-20(18)28(38)32(26)24-7-1-14(10-22(24)30(40)41)9-15-2-8-25(23(11-15)31(42)43)33-27(37)19-6-4-17(35(46)47)13-21(19)29(33)39/h1-8,10-13H,9H2,(H,40,41)(H,42,43) |
| InChIKey | FAIUVHNQAVDVSZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 235.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|