C12H8N2O6 — CID 62343912
(E)-4-(5-nitro-1,3-dioxoisoindol-2-yl)but-2-enoic acid (PubChem CID 62343912) has the molecular formula C12H8N2O6 and a molecular weight of 276.20 g/mol. Its IUPAC name is (E)-4-(5-nitro-1,3-dioxoisoindol-2-yl)but-2-enoic acid.
| Compound Name | (E)-4-(5-nitro-1,3-dioxoisoindol-2-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 62343912 |
| Molecular Formula | C12H8N2O6 |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | (E)-4-(5-nitro-1,3-dioxoisoindol-2-yl)but-2-enoic acid |
| SMILES | O=C(O)/C=C/CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C12H8N2O6/c15-10(16)2-1-5-13-11(17)8-4-3-7(14(19)20)6-9(8)12(13)18/h1-4,6H,5H2,(H,15,16)/b2-1+ |
| InChIKey | VFBZRYUQPIZIBJ-OWOJBTEDSA-N |
| XLogP | 0.83 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|