C13H12N2O5 — CID 77022800
4-(7-nitro-1-oxo-3,4-dihydroisoquinolin-2-yl)but-2-enoic acid (PubChem CID 77022800) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 4-(7-nitro-1-oxo-3,4-dihydroisoquinolin-2-yl)but-2-enoic acid.
| Compound Name | 4-(7-nitro-1-oxo-3,4-dihydroisoquinolin-2-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 77022800 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 4-(7-nitro-1-oxo-3,4-dihydroisoquinolin-2-yl)but-2-enoic acid |
| SMILES | O=C(O)C=CCN1CCc2ccc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C13H12N2O5/c16-12(17)2-1-6-14-7-5-9-3-4-10(15(19)20)8-11(9)13(14)18/h1-4,8H,5-7H2,(H,16,17) |
| InChIKey | PJTFJTXQWAOSQR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|