C13H11F3N2O3 — CID 59621128
2,2,2-trifluoro-1-(5-methylidene-7-nitro-2,4-dihydro-1H-3-benzazepin-3-yl)ethanone (PubChem CID 59621128) has the molecular formula C13H11F3N2O3 and a molecular weight of 300.24 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(5-methylidene-7-nitro-2,4-dihydro-1H-3-benzazepin-3-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(5-methylidene-7-nitro-2,4-dihydro-1H-3-benzazepin-3-yl)ethanone |
|---|---|
| PubChem CID | 59621128 |
| Molecular Formula | C13H11F3N2O3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2,2,2-trifluoro-1-(5-methylidene-7-nitro-2,4-dihydro-1H-3-benzazepin-3-yl)ethanone |
| SMILES | C=C1CN(C(=O)C(F)(F)F)CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C13H11F3N2O3/c1-8-7-17(12(19)13(14,15)16)5-4-9-2-3-10(18(20)21)6-11(8)9/h2-3,6H,1,4-5,7H2 |
| InChIKey | IATUNJUERCMEIX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|