C17H15F3N4O6 — CID 108543719
5-nitro-2-[2-oxo-2-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 108543719) has the molecular formula C17H15F3N4O6 and a molecular weight of 428.32 g/mol. Its IUPAC name is 5-nitro-2-[2-oxo-2-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 5-nitro-2-[2-oxo-2-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108543719 |
| Molecular Formula | C17H15F3N4O6 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 5-nitro-2-[2-oxo-2-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C(CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)N1CCCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H15F3N4O6/c18-17(19,20)16(28)22-5-1-4-21(6-7-22)13(25)9-23-14(26)11-3-2-10(24(29)30)8-12(11)15(23)27/h2-3,8H,1,4-7,9H2 |
| InChIKey | NVTAKLCRIGDZQC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 121.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|