C23H22N4O8 — CID 108934965
2-[2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-2-oxoethyl]-5-nitroisoindole-1,3-dione (PubChem CID 108934965) has the molecular formula C23H22N4O8 and a molecular weight of 482.45 g/mol. Its IUPAC name is 2-[2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-2-oxoethyl]-5-nitroisoindole-1,3-dione.
| Compound Name | 2-[2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-2-oxoethyl]-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 108934965 |
| Molecular Formula | C23H22N4O8 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 2-[2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-2-oxoethyl]-5-nitroisoindole-1,3-dione |
| SMILES | COc1ccc(C(=O)N2CCN(C(=O)CN3C(=O)c4ccc([N+](=O)[O-])cc4C3=O)CC2)cc1OC |
| InChI | InChI=1S/C23H22N4O8/c1-34-18-6-3-14(11-19(18)35-2)21(29)25-9-7-24(8-10-25)20(28)13-26-22(30)16-5-4-15(27(32)33)12-17(16)23(26)31/h3-6,11-12H,7-10,13H2,1-2H3 |
| InChIKey | MOVPMBDBOSQNSZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 139.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|