C18H17F3N4O6 — CID 108932792
2,2,2-trifluoro-N-[[1-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]methyl]acetamide (PubChem CID 108932792) has the molecular formula C18H17F3N4O6 and a molecular weight of 442.35 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[1-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[[1-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 108932792 |
| Molecular Formula | C18H17F3N4O6 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2,2,2-trifluoro-N-[[1-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]methyl]acetamide |
| SMILES | O=C(CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)N1CCC(CNC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H17F3N4O6/c19-18(20,21)17(29)22-8-10-3-5-23(6-4-10)14(26)9-24-15(27)12-2-1-11(25(30)31)7-13(12)16(24)28/h1-2,7,10H,3-6,8-9H2,(H,22,29) |
| InChIKey | NKUTYSKQPXYPEH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|