C20H18N6O6 — CID 108557417
N-[1-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]pyrazine-2-carboxamide (PubChem CID 108557417) has the molecular formula C20H18N6O6 and a molecular weight of 438.40 g/mol. Its IUPAC name is N-[1-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]pyrazine-2-carboxamide.
| Compound Name | N-[1-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 108557417 |
| Molecular Formula | C20H18N6O6 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N-[1-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]pyrazine-2-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)CN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)CC1)c1cnccn1 |
| InChI | InChI=1S/C20H18N6O6/c27-17(11-25-19(29)14-2-1-13(26(31)32)9-15(14)20(25)30)24-7-3-12(4-8-24)23-18(28)16-10-21-5-6-22-16/h1-2,5-6,9-10,12H,3-4,7-8,11H2,(H,23,28) |
| InChIKey | CSTZWUHSZVIJMF-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 155.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|