C26H26N4O8 — CID 108927451
[3-[[1-[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoyl]piperidin-4-yl]carbamoyl]phenyl] acetate (PubChem CID 108927451) has the molecular formula C26H26N4O8 and a molecular weight of 522.51 g/mol. Its IUPAC name is [3-[[1-[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoyl]piperidin-4-yl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[1-[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoyl]piperidin-4-yl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108927451 |
| Molecular Formula | C26H26N4O8 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | [3-[[1-[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoyl]piperidin-4-yl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NC2CCN(C(=O)CCCN3C(=O)c4ccc([N+](=O)[O-])cc4C3=O)CC2)c1 |
| InChI | InChI=1S/C26H26N4O8/c1-16(31)38-20-5-2-4-17(14-20)24(33)27-18-9-12-28(13-10-18)23(32)6-3-11-29-25(34)21-8-7-19(30(36)37)15-22(21)26(29)35/h2,4-5,7-8,14-15,18H,3,6,9-13H2,1H3,(H,27,33) |
| InChIKey | HOEXTKKZVMQHGM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 156.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|