C23H23N3O4 — CID 108555965
N-[1-[3-(1,3-dioxoisoindol-2-yl)propanoyl]piperidin-4-yl]benzamide (PubChem CID 108555965) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-[1-[3-(1,3-dioxoisoindol-2-yl)propanoyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[3-(1,3-dioxoisoindol-2-yl)propanoyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108555965 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-[1-[3-(1,3-dioxoisoindol-2-yl)propanoyl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(C(=O)CCN2C(=O)c3ccccc3C2=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H23N3O4/c27-20(12-15-26-22(29)18-8-4-5-9-19(18)23(26)30)25-13-10-17(11-14-25)24-21(28)16-6-2-1-3-7-16/h1-9,17H,10-15H2,(H,24,28) |
| InChIKey | ONTRTWCXGVJUSI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|