C18H24N4O5S — CID 108564716
2-[3-[4-(dimethylsulfamoylamino)piperidin-1-yl]-3-oxopropyl]-1,3-dioxoisoindole (PubChem CID 108564716) has the molecular formula C18H24N4O5S and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-[3-[4-(dimethylsulfamoylamino)piperidin-1-yl]-3-oxopropyl]-1,3-dioxoisoindole.
| Compound Name | 2-[3-[4-(dimethylsulfamoylamino)piperidin-1-yl]-3-oxopropyl]-1,3-dioxoisoindole |
|---|---|
| PubChem CID | 108564716 |
| Molecular Formula | C18H24N4O5S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-[3-[4-(dimethylsulfamoylamino)piperidin-1-yl]-3-oxopropyl]-1,3-dioxoisoindole |
| SMILES | CN(C)S(=O)(=O)NC1CCN(C(=O)CCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C18H24N4O5S/c1-20(2)28(26,27)19-13-7-10-21(11-8-13)16(23)9-12-22-17(24)14-5-3-4-6-15(14)18(22)25/h3-6,13,19H,7-12H2,1-2H3 |
| InChIKey | USAALJBHKRXPSH-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|