C23H23N3O6 — CID 108558162
N-[1-[3-(1,3-dioxoisoindol-2-yl)propanoyl]piperidin-4-yl]-3,5-dihydroxybenzamide (PubChem CID 108558162) has the molecular formula C23H23N3O6 and a molecular weight of 437.45 g/mol. Its IUPAC name is N-[1-[3-(1,3-dioxoisoindol-2-yl)propanoyl]piperidin-4-yl]-3,5-dihydroxybenzamide.
| Compound Name | N-[1-[3-(1,3-dioxoisoindol-2-yl)propanoyl]piperidin-4-yl]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 108558162 |
| Molecular Formula | C23H23N3O6 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-[1-[3-(1,3-dioxoisoindol-2-yl)propanoyl]piperidin-4-yl]-3,5-dihydroxybenzamide |
| SMILES | O=C(NC1CCN(C(=O)CCN2C(=O)c3ccccc3C2=O)CC1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C23H23N3O6/c27-16-11-14(12-17(28)13-16)21(30)24-15-5-8-25(9-6-15)20(29)7-10-26-22(31)18-3-1-2-4-19(18)23(26)32/h1-4,11-13,15,27-28H,5-10H2,(H,24,30) |
| InChIKey | WITULMFGTSXKME-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|