C19H20F3N3O4 — CID 108548744
N-[1-[4-(1,3-dioxoisoindol-2-yl)butanoyl]piperidin-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 108548744) has the molecular formula C19H20F3N3O4 and a molecular weight of 411.38 g/mol. Its IUPAC name is N-[1-[4-(1,3-dioxoisoindol-2-yl)butanoyl]piperidin-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[1-[4-(1,3-dioxoisoindol-2-yl)butanoyl]piperidin-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 108548744 |
| Molecular Formula | C19H20F3N3O4 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-[1-[4-(1,3-dioxoisoindol-2-yl)butanoyl]piperidin-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)N1CCC(NC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H20F3N3O4/c20-19(21,22)18(29)23-12-7-10-24(11-8-12)15(26)6-3-9-25-16(27)13-4-1-2-5-14(13)17(25)28/h1-2,4-5,12H,3,6-11H2,(H,23,29) |
| InChIKey | AVESVKZKRBYPBJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|