C21H29N3O5S — CID 108566307
N-[1-[4-(1,3-dioxoisoindol-2-yl)butanoyl]piperidin-4-yl]butane-1-sulfonamide (PubChem CID 108566307) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is N-[1-[4-(1,3-dioxoisoindol-2-yl)butanoyl]piperidin-4-yl]butane-1-sulfonamide.
| Compound Name | N-[1-[4-(1,3-dioxoisoindol-2-yl)butanoyl]piperidin-4-yl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 108566307 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N-[1-[4-(1,3-dioxoisoindol-2-yl)butanoyl]piperidin-4-yl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NC1CCN(C(=O)CCCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C21H29N3O5S/c1-2-3-15-30(28,29)22-16-10-13-23(14-11-16)19(25)9-6-12-24-20(26)17-7-4-5-8-18(17)21(24)27/h4-5,7-8,16,22H,2-3,6,9-15H2,1H3 |
| InChIKey | APWNPGSLVFBJOF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|